![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | nsdap-feder.pdf | 2023-11-16 15:58 | 50M | |
![[ ]](/icons/layout.gif) | İlikçi - Corporatist Tendencies in Durkheim's Conservatism-Middle East Technical University (2001) b.pdf | 2023-10-25 00:34 | 37M | |
![[ ]](/icons/layout.gif) | (Kimdir Nedir Serisi No 7) Peyami Safa - Olivera Salazar Kimdir-Korporatizm Nedir_ Olivera Salazar'ın Hatı, Korporatizmin Esasları. 7-Tasvir Neşriyatı (1945).pdf | 2023-10-26 10:18 | 26M | |
![[ ]](/icons/layout.gif) | Miller Lane_ Leila J. Rupp_ Alfred Rosenberg_ Dietrich Eckart_ Gottfried Feder_ Joseph Goebbels_ Otto Strasser_ Gregor Strasser_ Heinrich Himmler_ Richard Walther Darrè - Nazi Ideology Before.pdf | 2023-11-21 01:01 | 22M | |
![[ ]](/icons/layout.gif) | Steiger, What once was desert shall be a world--Getulio Vargas and westward expansion in Brazil, 1930-1945 (PhD, Univ of California, Los Angeles, 1995).pdf | 2023-12-07 02:32 | 20M | |
![[ ]](/icons/layout.gif) | Julius Evola - Revolt against the modern world-Inner Traditions (1995).pdf | 2023-11-19 14:33 | 18M | |
![[ ]](/icons/layout.gif) | Koralturk, Avukatligin Turklestirilmesi.pdf | 2023-12-08 13:24 | 16M | |
![[ ]](/icons/layout.gif) | Peker, Inkilab Dersleri Notlari (1935).pdf | 2023-12-06 12:02 | 13M | |
![[ ]](/icons/layout.gif) | Bowen, German theories of the corporative State.pdf | 2023-10-18 10:02 | 12M | |
![[ ]](/icons/layout.gif) | Loewenstein, Brazil under Vargas.pdf | 2023-12-04 03:00 | 12M | |
![[ ]](/icons/layout.gif) | Elbow, French corporative theory, 1789 - Matthew H.pdf | 2023-10-18 10:06 | 11M | |
![[ ]](/icons/layout.gif) | Field, The Syndical and Corporative Institutions of Italian Fascism (1938).pdf | 2023-10-25 01:07 | 9.1M | |
![[ ]](/icons/layout.gif) | Wiarda, Corporatism and comparative pol - Howard J., 1939-.pdf | 2023-10-18 09:57 | 7.8M | |
![[ ]](/icons/layout.gif) | Parla - Social and Political Thought of Ziya Gokalp, 1876-1924 (1985).pdf | 2023-10-18 10:20 | 7.3M | |
![[ ]](/icons/layout.gif) | Evans, The Third Reich in Power--Ch.4--Prosperity and Plunder.pdf | 2023-11-16 16:43 | 5.6M | |
![[ ]](/icons/layout.gif) | Evans, The Third Reich in Power--Ch.5--People's Community.pdf | 2023-11-16 16:45 | 5.2M | |
![[ ]](/icons/layout.gif) | Grimmer-Solem, The Science of Progress--The Rise of Historical Economics and Social Reform in Germany, 1864-1894 (PhD, Oxford, 1998).pdf | 2023-11-09 12:01 | 5.2M | |
![[ ]](/icons/layout.gif) | Karaömerlioğlu, Orada_Bir_Köy_Var_Uzakta_İletişim_Yayınları.pdf | 2023-12-08 12:43 | 5.1M | |
![[ ]](/icons/layout.gif) | Durkheim - Durkheim on Politics and the State-Stanford University Press (1986).pdf | 2023-11-10 13:54 | 5.0M | |
![[ ]](/icons/layout.gif) | Diamant, Austrian Catholics and the Social Question (1959).pdf | 2023-11-07 22:53 | 4.9M | |
![[ ]](/icons/layout.gif) | Bramwell, Blood_and_Soil_Walther_Darré_and_Hitler’s_Green_Party.pdf | 2023-11-16 15:39 | 4.8M | |
![[ ]](/icons/layout.gif) | Landauer, Corporate state ideologies.pdf | 2023-10-18 10:11 | 4.5M | |
![[ ]](/icons/layout.gif) | Maksudyan, Türklüğü Ölçmek (Metis Yayınları).pdf | 2023-12-07 02:49 | 4.4M | |
![[ ]](/icons/layout.gif) | Maksudyan, Türklüğü Ölçmek (Metis Yayınları)(1).pdf | 2023-12-08 12:34 | 4.4M | |
![[ ]](/icons/layout.gif) | Boyer-EndOldRegime-1986.pdf | 2023-11-07 13:08 | 4.2M | |
![[ ]](/icons/layout.gif) | Schmitter-StillCenturyCorporatism-1974.pdf | 2023-11-07 22:28 | 4.2M | |
![[ ]](/icons/layout.gif) | Parla - Ziya Gökalp, Kemalizm ve Türkiye’de Korporatizm-İletişim Yayınları (1993).pdf | 2023-10-18 10:18 | 4.0M | |
![[ ]](/icons/layout.gif) | Parla - Ziya Gökalp, Kemalizm ve Türkiye’de Korporatizm-İletişim Yayınları (1993)(1).pdf | 2023-12-08 12:38 | 4.0M | |
![[ ]](/icons/layout.gif) | Harley, Syndicalism ().pdf | 2023-10-28 16:58 | 3.6M | |
![[ ]](/icons/layout.gif) | Guichonnet, Mussolini ve Faşizm İletişim Yayınları.pdf | 2023-11-21 01:08 | 3.3M | |
![[ ]](/icons/layout.gif) | Misner-CatholicLaborCatholic-2004.pdf | 2023-11-29 15:43 | 3.3M | |
![[ ]](/icons/layout.gif) | WINKLER-Corporatism-1976.pdf | 2023-11-07 21:59 | 3.2M | |
![[ ]](/icons/layout.gif) | Darré, A New Nobility of Blood and Soil by Richard Walther (1930).pdf | 2023-11-16 16:16 | 3.1M | |
![[ ]](/icons/layout.gif) | Thorpe-AustrofascismRevisitingAuthoritarian-2010.pdf | 2023-11-07 13:13 | 3.0M | |
![[ ]](/icons/layout.gif) | Elliott-MussoliniProphetPragmatic-1926.pdf | 2023-10-25 12:52 | 2.9M | |
![[ ]](/icons/layout.gif) | Ridley, Revolutionary syndicalism in France--Ch.--The Revolt Against Reason.pdf | 2023-11-10 14:14 | 2.9M | |
![[ ]](/icons/layout.gif) | Crossick-MetaphorsMiddleDiscovery-1994.pdf | 2023-11-08 10:45 | 2.9M | |
![[ ]](/icons/layout.gif) | Love, Crafting the Third World--Ch.5--Manoilescu, 1.pdf | 2023-11-28 00:28 | 2.8M | |
![[ ]](/icons/layout.gif) | Brose-GenericFascismRevisited-1987.pdf | 2023-11-08 10:33 | 2.8M | |
![[ ]](/icons/layout.gif) | Dulles - Vargas of Brazil_ A Political Biography--Book 6, 1937-1938.pdf | 2023-12-04 03:10 | 2.7M | |
![[ ]](/icons/layout.gif) | Farrenkopf-SpenglersDerMensch-1991.pdf | 2023-11-09 11:14 | 2.6M | |
![[ ]](/icons/layout.gif) | Zeldin, France, 1848-1945. Vol. 1--Ch.Solidarism.pdf | 2023-11-10 14:18 | 2.4M | |
![[ ]](/icons/layout.gif) | Pope-InsideOrganicSolidarity-1983.pdf | 2023-11-09 21:48 | 2.4M | |
![[ ]](/icons/layout.gif) | Kamenetsky-FolklorePoliticalTool-1972.pdf | 2023-11-29 15:53 | 2.4M | |
![[ ]](/icons/layout.gif) | Mason, Nazism, fascism and the working--Ch.3--National Labour.pdf | 2023-11-16 15:24 | 2.3M | |
![[ ]](/icons/layout.gif) | Bowen, German Theories--Ch.2.pdf | 2023-10-26 10:07 | 2.3M | |
![[ ]](/icons/layout.gif) | Basch, The Fascist--His State and His Mind--Ch.5--The Administrative Structure.pdf | 2023-11-07 17:47 | 2.3M | |
![[ ]](/icons/layout.gif) | Sternhell, The birth of fascist ideology--Ch.1--Georges Sorel.pdf | 2023-11-10 23:14 | 2.3M | |
![[ ]](/icons/layout.gif) | Hayward-SolidarityReformistSociology-1963.pdf | 2023-10-25 12:45 | 2.2M | |
![[ ]](/icons/layout.gif) | Schoenfeld-DurkheimsConceptJustice-1989.pdf | 2023-10-25 15:28 | 2.1M | |
![[ ]](/icons/layout.gif) | Love, Crafting the Third World--Ch.6--Manoilescu, 2.pdf | 2023-11-28 00:30 | 2.1M | |
![[ ]](/icons/layout.gif) | Love, Crafting the Third World--Ch.6--Manoilescu, 2(2).pdf | 2023-11-28 00:33 | 2.1M | |
![[ ]](/icons/layout.gif) | Love, Crafting the Third World--Ch.6--Manoilescu, 2(1).pdf | 2023-11-28 00:31 | 2.1M | |
![[ ]](/icons/layout.gif) | KaufmanOsborn-EmileDurkheimScience-1986.pdf | 2023-11-21 13:30 | 2.1M | |
![[ ]](/icons/layout.gif) | pryor, Corporatism as an Economic System (1988).pdf | 2023-11-07 21:56 | 2.0M | |
![[ ]](/icons/layout.gif) | Elbow, French Corporative Theory--Ch.1.pdf | 2023-10-24 23:57 | 2.0M | |
![[ ]](/icons/layout.gif) | Lovin-AgriculturalReorganizationThird-1969.pdf | 2023-11-15 10:57 | 2.0M | |
![[ ]](/icons/layout.gif) | Hawkins-DurkheimOccupationalCorporations-1994.pdf | 2023-10-25 12:57 | 2.0M | |
![[ ]](/icons/layout.gif) | BORGESE-INTELLECTUALORIGINSFASCISM-1934.pdf | 2023-11-08 10:37 | 2.0M | |
![[ ]](/icons/layout.gif) | Bowen, German Theories--Ch.4.pdf | 2023-10-26 10:13 | 1.9M | |
![[ ]](/icons/layout.gif) | Betz-SCHMOLLERSOMBART-1993.pdf | 2023-11-07 22:44 | 1.9M | |
![[ ]](/icons/layout.gif) | Ball-LeadershipPrincipleNational-1942.pdf | 2023-11-07 22:42 | 1.8M | |
![[ ]](/icons/layout.gif) | HEARN-DurkheimsPoliticalSociology-1985.pdf | 2023-11-21 13:27 | 1.8M | |
![[ ]](/icons/layout.gif) | Gangas-ValuesKnowledgeSolidarity-2011.pdf | 2023-11-09 11:42 | 1.8M | |
![[ ]](/icons/layout.gif) | Prendergast-IMPACTFUSTELDE-1983.pdf | 2023-11-09 22:05 | 1.8M | |
![[ ]](/icons/layout.gif) | Guse-VolksgemeinschaftEngineersNazi-2011.pdf | 2023-11-29 15:34 | 1.8M | |
![[ ]](/icons/layout.gif) | Kedar, National Socialism before Nazism--Friedrich Naumann and Theodor Fritsch, 1890-1914 (PhD, Berkeley, 2010).pdf | 2023-11-09 12:33 | 1.8M | |
![[ ]](/icons/layout.gif) | Jones, The French state in question--Ch.6--Durkheim, Duguit and the State.pdf | 2023-12-03 00:37 | 1.7M | |
![[ ]](/icons/layout.gif) | Kandel-EducationNaziGermany-1935.pdf | 2023-11-29 15:59 | 1.7M | |
![[ ]](/icons/layout.gif) | Friedman-CapitalismRepublicanismSocialism-1990.pdf | 2023-11-09 11:45 | 1.7M | |
![[ ]](/icons/layout.gif) | Chamberlain-FavorableAspectsState-1891.pdf | 2023-11-09 12:03 | 1.7M | |
![[ ]](/icons/layout.gif) | Rock (editor) - Latin America in the 1940s--Ch.6--French, The Populist Gamble of Vargas in 1945.pdf | 2023-12-04 02:56 | 1.6M | |
![[ ]](/icons/layout.gif) | Rifkind, Everything_in_the_state_nothing_against the State.pdf | 2023-12-06 12:06 | 1.6M | |
![[ ]](/icons/layout.gif) | HAMBURGER-SIGNIFICANCENAZILEISURE-1945.pdf | 2023-11-29 15:39 | 1.6M | |
![[ ]](/icons/layout.gif) | Cotterrell-DurkheimLegalDevelopment-1977.pdf | 2023-10-25 15:20 | 1.6M | |
![[ ]](/icons/layout.gif) | Sorel, Reflections on violence--Letter to Daniel Halevy.pdf | 2023-11-10 23:19 | 1.6M | |
![[ ]](/icons/layout.gif) | Basch, The Fascist--His State and His Mind--Ch.3--The Political Structure.pdf | 2023-11-07 17:41 | 1.5M | |
![[ ]](/icons/layout.gif) | De Meneses, The Origins and Nature of Authoritarian Rule in Portugal, 1919-1945.pdf | 2023-11-08 10:49 | 1.5M | |
![[ ]](/icons/layout.gif) | Hamburger-GermanLaborFront-1944.pdf | 2023-11-28 13:59 | 1.5M | |
![[ ]](/icons/layout.gif) | Curtis, Three against the Third Republic--Ch.6--Attack on Decadence.pdf | 2023-11-21 01:22 | 1.4M | |
![[ ]](/icons/layout.gif) | Hayward-SolidarityReformistSociology-1963 (2).pdf | 2023-10-25 12:48 | 1.4M | |
![[ ]](/icons/layout.gif) | ARMIERO-GreenRhetoricBlackshirts-2013.pdf | 2023-11-15 11:13 | 1.4M | |
![[ ]](/icons/layout.gif) | Constitution and functions of t - Comitati d'azione per l'univers.pdf | 2023-10-26 10:54 | 1.4M | |
![[ ]](/icons/layout.gif) | Rizescu, Social Policy and the Corporatist Design (2016).pdf | 2023-11-28 00:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Basch, The Fascist--His State and His Mind--Ch.4--The Economic Structure.pdf | 2023-11-07 17:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Elbow, French Corporative Theory--Ch.2.pdf | 2023-10-25 00:22 | 1.3M | |
![[ ]](/icons/layout.gif) | Wiarda - Comparative Politics--Ch.5.pdf | 2023-11-06 11:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Elbow, French Corporative Theory--Ch.4.pdf | 2023-10-25 00:29 | 1.2M | |
![[ ]](/icons/layout.gif) | Levine, Father of the poor-- Vargas and His Era--Ch.3--The Estado Novo.pdf | 2023-12-04 02:48 | 1.2M | |
![[ ]](/icons/layout.gif) | BACH-INDIVIDUALISMLEGITIMATIONPARADOXES-1990.pdf | 2023-11-21 13:49 | 1.2M | |
![[ ]](/icons/layout.gif) | Öztan, Korporatizm--Ch.10--Modern Siyasal Ideolojiler.pdf | 2023-11-06 11:29 | 1.2M | |
![[ ]](/icons/layout.gif) | Schneider, The Fascist Government of Italy--Ch.4--The Corporative System (1936).pdf | 2023-11-06 11:15 | 1.1M | |
![[ ]](/icons/layout.gif) | Rizescu, Corporatism_in_Interwar_Romania_Overlapping Sources and Competing Varieties (2021).pdf | 2023-11-28 00:47 | 1.1M | |
![[ ]](/icons/layout.gif) | WUNDERLICH-EDUCATIONNAZIGERMANY-1937.pdf | 2023-11-29 15:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Kirk-DictatorshipFascismDemise-2016.pdf | 2023-11-09 12:47 | 1.1M | |
![[ ]](/icons/layout.gif) | Bowen, German Theories--Introduction.pdf | 2023-10-25 01:12 | 1.1M | |
![[ ]](/icons/layout.gif) | Kedar-NATIONALSOCIALISMNAZISM-2013.pdf | 2023-11-09 12:36 | 1.0M | |
![[ ]](/icons/layout.gif) | Tucker, French revolutionary syndicalis--Ch.1--The Belle Epoque.pdf | 2023-11-10 13:58 | 1.0M | |
![[ ]](/icons/layout.gif) | Williamson, Corporatism in Perspective, Ch.2.pdf | 2023-10-25 00:10 | 1.0M | |
![[ ]](/icons/layout.gif) | Koschorke - On Hitler’s Mein Kampf_ The Poetics of National Socialism-MIT Press (2017).pdf | 2023-11-17 14:21 | 1.0M | |
![[ ]](/icons/layout.gif) | Koschorke - On Hitler’s Mein Kampf_ The Poetics of National Socialism-MIT Press (2017)(1).pdf | 2023-11-17 14:24 | 1.0M | |
![[ ]](/icons/layout.gif) | BRANDT-FARMRELIEFGERMANY-1934.pdf | 2023-11-28 14:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Curtis, Three against the Third Republic--Ch.7--Intellectuals and the Need for Action.pdf | 2023-11-21 01:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Deak-DismantlingEmpire-2010.pdf | 2023-11-09 10:56 | 1.0M | |
![[ ]](/icons/layout.gif) | HAYWARD-OFFICIALSOCIALPHILOSOPHY-1961.pdf | 2023-10-25 12:41 | 1.0M | |
![[ ]](/icons/layout.gif) | Wunderlich-ChangingStatusGerman-1948.pdf | 2023-11-29 15:48 | 1.0M | |
![[ ]](/icons/layout.gif) | gerber, Corporatism and the State Theory (1995).pdf | 2023-11-09 11:39 | 1.0M | |
![[ ]](/icons/layout.gif) | Williamson, Corporatism in Perspective, Ch.6.pdf | 2023-11-07 22:22 | 961K | |
![[ ]](/icons/layout.gif) | Salvati-LongHistoryCorporatism-2006.pdf | 2023-11-09 21:59 | 950K | |
![[ ]](/icons/layout.gif) | Roth-RootsItalianFascism-1967.pdf | 2023-11-21 13:45 | 924K | |
![[ ]](/icons/layout.gif) | Curtis, Three against the Third Republic--Ch.4--Attack on Democracy.pdf | 2023-11-21 01:16 | 908K | |
![[ ]](/icons/layout.gif) | Farrenkopf-EARLYPHASESPENGLERS-1992.pdf | 2023-11-09 11:10 | 906K | |
![[ ]](/icons/layout.gif) | Cawson, Corporatism and political theory--Ch.2--What Is Corporatism.pdf | 2023-11-07 08:19 | 903K | |
![[ ]](/icons/layout.gif) | Coste-SOCIALECONOMYCONSTANTIN-2017.pdf | 2023-11-08 10:30 | 900K | |
![[ ]](/icons/layout.gif) | Williamson, Varieties of corporatism--Ch.7--Corporatism and the Portuguese Estado Novo.pdf | 2023-11-07 22:08 | 896K | |
![[ ]](/icons/layout.gif) | Erdem, Tez--Birinci Bolum.pdf | 2023-10-21 15:08 | 889K | |
![[ ]](/icons/layout.gif) | Harris-SombartGermanNational-1942.pdf | 2023-11-07 13:16 | 875K | |
![[ ]](/icons/layout.gif) | HAYWARD-SOLIDARITYSOCIALHISTORY-1959.pdf | 2023-10-25 13:00 | 860K | |
![[ ]](/icons/layout.gif) | Williamson, Varieties of corporatism--Ch.6--Corporatism and Fascist Italy.pdf | 2023-11-07 22:12 | 858K | |
![[ ]](/icons/layout.gif) | Palonen-SombartWeberProfessional-2005.pdf | 2023-11-07 13:22 | 855K | |
![[ ]](/icons/layout.gif) | Landauer, Ch.5--Reawakening of Corporatism.pdf | 2023-10-21 15:21 | 821K | |
![[ ]](/icons/layout.gif) | Cawson, Corporatism and political theory--Ch.1--Why Corporatism.pdf | 2023-11-06 11:40 | 812K | |
![[ ]](/icons/layout.gif) | Curtis, Three against the Third Republic--Ch.5--Attack on the Revolution.pdf | 2023-11-21 01:19 | 802K | |
![[ ]](/icons/layout.gif) | Curtis, Three against the Third Republic--Ch.5--Attack on the Revolution(1).pdf | 2023-11-21 01:21 | 802K | |
![[ ]](/icons/layout.gif) | Barnes-DurkheimsContributionReconstruction-1920.pdf | 2023-11-07 08:23 | 799K | |
![[ ]](/icons/layout.gif) | Botz-ShortLongTermEffects-2016.pdf | 2023-11-07 08:34 | 798K | |
![[ ]](/icons/layout.gif) | Deak-Austria1920s-2016.pdf | 2023-11-09 10:59 | 796K | |
![[ ]](/icons/layout.gif) | Daniels, Fascist Education in Brazil's Estado Novo Dictatorship (2020).pdf | 2023-12-04 02:52 | 792K | |
![[ ]](/icons/layout.gif) | DREHER-SPENGLERTHIRDREICH-1939.pdf | 2023-11-09 10:47 | 789K | |
![[ ]](/icons/layout.gif) | Brandom-VIOLENCETRANSLATION-2017.pdf | 2023-11-09 21:52 | 788K | |
![[ ]](/icons/layout.gif) | Albernaz-TechnicalCouncilsBrazilian-2016.pdf | 2023-11-28 14:13 | 783K | |
![[ ]](/icons/layout.gif) | Atak, Tez--BirinciBolum.pdf | 2023-10-21 15:05 | 779K | |
![[ ]](/icons/layout.gif) | Wiarda, Corporatism--Ch.2.pdf | 2023-10-25 00:03 | 775K | |
![[ ]](/icons/layout.gif) | Elbow, French Corporative Theory--Ch.3.pdf | 2023-10-25 00:26 | 769K | |
![[ ]](/icons/layout.gif) | Corni, Hitler and the peasants--Ch.7--Erbhof.pdf | 2023-11-16 15:28 | 749K | |
![[ ]](/icons/layout.gif) | Kirk-IdeologyPoliticsState-2011.pdf | 2023-11-07 13:02 | 741K | |
![[ ]](/icons/layout.gif) | HAYWARD-EDUCATIONALPRESSUREGROUPS-1963.pdf | 2023-11-09 11:57 | 735K | |
![[ ]](/icons/layout.gif) | Deak-IgnazSeipel18761932-2012.pdf | 2023-11-09 10:52 | 710K | |
![[ ]](/icons/layout.gif) | makler, Portuguese Industrial Elite and Its Corporative Relations (1976).pdf | 2023-11-09 21:45 | 658K | |
![[ ]](/icons/layout.gif) | BenGhiat-ItalianFascismAesthetics-1996.pdf | 2023-11-08 10:40 | 652K | |
![[ ]](/icons/layout.gif) | Ritter-HabsburgHitlerHaider-1999.pdf | 2023-11-07 13:05 | 593K | |
![[ ]](/icons/layout.gif) | Chirot-CorporatistModelSocialism-1980.pdf | 2023-11-07 17:22 | 562K | |
![[ ]](/icons/layout.gif) | Hawkins-ContinuityChangeDurkheims-1979.pdf | 2023-10-25 12:54 | 554K | |
![[ ]](/icons/layout.gif) | Hausheer-ModifiedNaziPhilosophy-1938.pdf | 2023-11-09 12:24 | 517K | |
![[ ]](/icons/layout.gif) | Holmes-ForsakenPastAgrarian-1982.pdf | 2023-11-29 15:56 | 515K | |
![[ ]](/icons/layout.gif) | Sedgwick - Key Thinkers Of The Radical Right--Ch.1--Oswald Spengler.pdf | 2023-11-10 14:03 | 492K | |
![[ ]](/icons/layout.gif) | Sedgwick - Key Thinkers Of The Radical Right--Ch.3--Carl Schmitt.pdf | 2023-11-10 14:09 | 489K | |
![[ ]](/icons/layout.gif) | Williamson, Varieties of corporatism--Ch.4--Corporatist Thought.pdf | 2023-11-07 22:15 | 483K | |
![[ ]](/icons/layout.gif) | Lovin, Blut und Boden--The Ideological Basis of the Nazi Agricultural Program (1967).pdf | 2023-11-19 14:26 | 482K | |
![[ ]](/icons/layout.gif) | Sedgwick - Key Thinkers Of The Radical Right--Ch.2--Ernst Junger.pdf | 2023-11-10 14:06 | 471K | |
![[ ]](/icons/layout.gif) | Corni, Hitler and the peasants--Conclusion.pdf | 2023-11-16 15:33 | 467K | |
![[ ]](/icons/layout.gif) | Pasetti, The Fascist Labour Charter.pdf | 2023-10-26 10:38 | 443K | |
![[ ]](/icons/layout.gif) | Cerasi, Rethinking Italian Corporatism.pdf | 2023-10-26 10:46 | 419K | |
![[ ]](/icons/layout.gif) | Cardoso and Ferreira, The Corporatist Chamber of the New State in Portugal.pdf | 2023-10-26 10:42 | 415K | |
![[ ]](/icons/layout.gif) | Goldschmidt and Storring, Gustav Schmoller--Ch.5--Stefan Berger.pdf | 2023-11-09 11:37 | 387K | |
![[ ]](/icons/layout.gif) | Solonari-NationalistUtopianismOrientalist-2016.pdf | 2023-11-15 11:07 | 351K | |
![[ ]](/icons/layout.gif) | Landauer, Ch.3--Immediate Ancestors.pdf | 2023-10-21 15:17 | 350K | |
![[ ]](/icons/layout.gif) | Gurbuz, Le Play'nin Sosyal Baris Duzeni ile Bourgeois--Dayanismacilik.pdf | 2023-10-26 11:01 | 342K | |
![[ ]](/icons/layout.gif) | Sorel, Reflections on violence--Introduction to the First Publication.pdf | 2023-11-10 23:22 | 336K | |
![[ ]](/icons/layout.gif) | Bakota-GetulioVargasEstado-1979.pdf | 2023-11-28 14:19 | 322K | |
![[ ]](/icons/layout.gif) | Smith-ZiyaGokalpEmileDurkheim-1995.pdf | 2023-11-21 13:36 | 315K | |
![[ ]](/icons/layout.gif) | Pelt, The Establishment and Development of the Metaxas Regime in the Context of Nazi Fascism 1936-41.pdf | 2023-12-05 13:17 | 286K | |
![[ ]](/icons/layout.gif) | Carstocea, Native Fascists, Transnational Anti-Semites.pdf | 2023-11-07 17:35 | 280K | |
![[ ]](/icons/layout.gif) | Ninhos, The Estado Novo and Portuguese-German Relations.pdf | 2023-11-07 17:28 | 272K | |
![[ ]](/icons/layout.gif) | Musat-LessonsModernLiving-2015.pdf | 2023-11-15 11:03 | 262K | |
![[ ]](/icons/layout.gif) | libal, Staging Turkish Women's Emancipation, Istanbul 1935 (2008).pdf | 2023-12-08 13:17 | 246K | |
![[ ]](/icons/layout.gif) | Rizescu, Competing_Voices_of_the_Drive_to_Planning--Corporatism in Romania.pdf | 2023-11-28 00:42 | 238K | |
![[ ]](/icons/layout.gif) | Kallis, Fascism and Religion--The Metaxas Regime in Greece and the Third Hellenic Civilisation.pdf | 2023-12-05 13:12 | 215K | |
![[ ]](/icons/layout.gif) | Frandsen, The war that we prefer--The Reclamation of the Pontine Marshes and Fascist Expansion.pdf | 2023-12-05 13:21 | 203K | |
![[ ]](/icons/layout.gif) | Berlin, Against the Current--Georges Sorel.pdf | 2023-11-10 23:09 | 191K | |
![[ ]](/icons/layout.gif) | Iordachi, Hybrid Totatlitarian Expreiments in Romania, 1937-44.pdf | 2023-11-09 12:10 | 186K | |
![[ ]](/icons/layout.gif) | Botz, The Coming of the Dollfuss-Schuschnigg Regime.pdf | 2023-11-09 12:15 | 170K | |
![[ ]](/icons/layout.gif) | Landauer, Ch.4--Corporatism in Semi-Dormancy.pdf | 2023-10-21 15:19 | 169K | |
![[ ]](/icons/layout.gif) | Unal, Erken Cumhuriyet Doneminde Gencligin Militarizasyonu.pdf | 2023-12-08 13:02 | 163K | |
![[ ]](/icons/layout.gif) | Unal, Erken Cumhuriyet Doneminde Gencligin Militarizasyonu(1).pdf | 2023-12-08 13:03 | 163K | |
![[ ]](/icons/layout.gif) | Gallagher, Salazar--Ch.4withNotes.pdf | 2023-11-07 23:27 | 157K | |
![[ ]](/icons/layout.gif) | madureira, Bureaucratic Rule in Authoritarian Portugal (2007).pdf | 2023-10-28 16:51 | 146K | |
![[ ]](/icons/layout.gif) | Grundmann and Stehr, Why_Is_Werner_Sombart_Not_Part_of_the_Core of Classical Sociology.pdf | 2023-11-09 12:28 | 136K | |
![[ ]](/icons/layout.gif) | alemdaroglu, Politics of the Body (2005).pdf | 2023-12-08 13:20 | 121K | |
![[ ]](/icons/layout.gif) | Adinolfi and Costa Pinto, Slazar's New State.pdf | 2023-10-28 16:56 | 117K | |
![[ ]](/icons/layout.gif) | Grimmer-Solem, Imperialist Socialism of the Chair--Ch.6 of Eley.pdf | 2023-11-07 23:22 | 116K | |
![[ ]](/icons/layout.gif) | Drechsler, The_German_Historical_School_and_Kathedersozialismus.pdf | 2023-11-07 22:38 | 116K | |
![[ ]](/icons/layout.gif) | pinto, Political Catholicism, Crisis of Democracy and Salazar's New State in Portugal (2007).pdf | 2023-11-09 22:09 | 112K | |
![[ ]](/icons/layout.gif) | Alemdaroglu, Eugenics, Modernity andf Nationalism.pdf | 2023-12-08 13:19 | 101K | |
![[ ]](/icons/layout.gif) | Sweeney, Work, Race--Introduction.pdf | 2023-11-09 21:55 | 76K | |
![[ ]](/icons/layout.gif) | Aydin, Use and Abuse of Archeology.pdf | 2023-12-08 13:06 | 59K | |
|